Molecular weights calculated on 03/09/15 | Molecular weights calculated on 03/11/15 |
Molar mass of CH4 is 16.04246 g/mol
Molar mass of carbon is dioxide g/mol
Molar mass of C2H4O2 is 60.05196 g/mol
Molar mass of KH2PO4 is 136,085542 g/mol
Molar mass of (C5H5NH)2PbCl6 is 580,13368 g/mol
Molar mass of (C5H5NH)2PbCl6 is 580,13368 g/mol
Molar mass of CaO5 is 120.075 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of C4H10 is 58.1222 g/mol
Molar mass of H3PO4 is 97,995182 g/mol
Molar mass of (CH2)12 is 168.31896 g/mol
Molar mass of C8H8O3 is 152.14732 g/mol
Molar mass of Cl3 is 106.359 g/mol
Molar mass of O4 is 63,9976 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of h2o is 18,01528 g/mol
Molar mass of Fe2O3 is + g/mol
Molar mass of Cu2(COOCH(C6H5)2)1(CH3(CH2)10COO)3 is 936.2574 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of NaCl2 is 93.89576928 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of methane is 16.04246 g/mol
Molar mass of C12H22O11 is 342.29648 g/mol
Molar mass of H2O3 is 50,01408 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of fe is 55.845 g/mol
Molar mass of Ca is 40.078 g/mol
Molar mass of Na3N is 82.97600784 g/mol
Molar mass of NaNH2 is 39.01234928 g/mol
Molar mass of CuSO4*5H2O is 249.685 g/mol
Molar mass of NaCl2CO3 is 153.90466928 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of NaClCO3 is 118.45166928 g/mol
Molar mass of NaC2H3O2*3H2O is 136.07962928 g/mol
Molar mass of Ca(HCO3)2 is 162.11168 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of NaCl3CO3 is 189.35766928 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of Na3Cl3CO3 is 235.33720784 g/mol
Molar mass of fe2o3 is 159.6882 g/mol
Molar mass of H2SO4 is 98.07848 g/mol
Molar mass of K2Cr2O7 is 294.1846 g/mol
Molar mass of NH4OH is 35.0458 g/mol
Molar mass of AgNO3 is 169,8731 g/mol
Molar mass of Ca(NO2)2 is 132.089 g/mol
Molar mass of NaNO3 is 84.99466928 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of SO3 is 80.0632 g/mol
Calculate molecular weight
Molecular weights calculated on 03/09/15 | Molecular weights calculated on 03/11/15 |
Molecular masses on 02/08/15
Molecular masses on 03/10/14
Please let us know how we can improve this web app.