Molecular weights calculated on 03/03/15 | Molecular weights calculated on 03/05/15 |
Molar mass of C6H12 is 84.15948 g/mol
Molar mass of C3H3NH3Cl is 91.53944 g/mol
Molar mass of C3H3NH3Cl is 91.53944 g/mol
Molar mass of BH4 is 14.84276 g/mol
Molar mass of BH4U(OSi(OBu)3)2 is 779.72343 g/mol
Molar mass of BH4U(OSi(OBu)3)2(OSi(OBu)2) is 970.03565 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of BH4U(OSi(OBu)3)2(OSi(OBu)) is 896.92199 g/mol
Molar mass of BH4U(OSi(OBu)3)2(OSi(OBu)2) is 970.03565 g/mol
Molar mass of U(OSi(OBu)3)2(OSi(OBu)2) is 955.19289 g/mol
Molar mass of NO2 is 46.0055 g/mol
Molar mass of (C6)(H6) is 78.11184 g/mol
Molar mass of (C6)(H6) is 78.11184 g/mol
Molar mass of c is 12.0107 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of Cl is 35.453 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of N is 14.0067 g/mol
Molar mass of Ba(MnO4)2 is 375.19829 g/mol
Molar mass of Ba(MnO4)2 is 375.19829 g/mol
Molar mass of HgO is 216.5894 g/mol
Molar mass of HgO is 216.5894 g/mol
Molar mass of AlCl3 is 133.3405386 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of MnCl4(H2O)2 is 232.780605 g/mol
Molar mass of CH3COOH is 60.05196 g/mol
Molar mass of Co is 58.933195 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Ni(oh)3 is 176.0802 g/mol
Molar mass of KNO3 is 101.1032 g/mol
Molar mass of S is 32.065 g/mol
Molar mass of K2Cr2O7 is 294.1846 g/mol
Molar mass of (NH4)2CO3 is 96.08582 g/mol
Molar mass of KI is 166.00277 g/mol
Molar mass of NiCl2 is 129.5994 g/mol
Molar mass of NiCl2 is 129.5994 g/mol
Molar mass of [Ni(NH2CH2CH2NH2)3]Cl2 is 309.89436 g/mol
Molar mass of Li(HCOO) is 51.95844 g/mol
Molar mass of NH4NO3 is 80.04336 g/mol
Molar mass of AlCl3 is 133.3405386 g/mol
Molar mass of KNO3 is 101.1032 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of K2CO3 is 138.2055 g/mol
Molar mass of K2CO3 is 138.2055 g/mol
Molar mass of C2H5 is ----→ g/mol
Molar mass of FeCl3 is 162.204 g/mol
Molar mass of [Cu(NH3)4]SO4 is 227.73068 g/mol
Calculate molecular weight
Molecular weights calculated on 03/03/15 | Molecular weights calculated on 03/05/15 |
Molecular masses on 02/02/15
Molecular masses on 03/04/14
Please let us know how we can improve this web app.