Molecular weights calculated on 02/10/15 | Molecular weights calculated on 02/12/15 |
Molar mass of ZnC6H6N4OS2 is 279.64804 g/mol
Molar mass of Ti2AlC is 134.7262386 g/mol
Molar mass of As2O3 is 197.8414 g/mol
Molar mass of Ti2AlC is 134.7262386 g/mol
Molar mass of ZnC12H24N8S2C2N2 is 461.91736 g/mol
Molar mass of TiC is 59.8777 g/mol
Molar mass of C3H6 is 42.07974 g/mol
Molar mass of H2 is 2.01588 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of MnO is 70.937445 g/mol
Molar mass of MnO is 70.937445 g/mol
Molar mass of Mn is 54.938045 g/mol
Molar mass of BF3 is 67.8062096 g/mol
Molar mass of Na2O2 is 77.97833856 g/mol
Molar mass of MgSO4 is 120.3676 g/mol
Molar mass of s3o3c12h18 is 306.46452 g/mol
Molar mass of NaCl5 is + g/mol
Molar mass of Ca8MgBi(PO4)7 is 1218.708934 g/mol
Molar mass of CS2 is 76.1407 g/mol
Molar mass of s3o3c12h18na is 329.45428928 g/mol
Molar mass of s3o3c12h18na is 329.45428928 g/mol
Molar mass of CuO is 79.5454 g/mol
Molar mass of mnO is 70.937445 g/mol
Molar mass of Mn3O4 is 228.811735 g/mol
Molar mass of s3o3c12h18 is 306.46452 g/mol
Molar mass of s3o3c12h18 is 306.46452 g/mol
Molar mass of N2F2 is 66.0102064 g/mol
Molar mass of s3o3c12h is 289.32954 g/mol
Molar mass of s3o3c12h is 289.32954 g/mol
Molar mass of Bi2O3 is 465.959 g/mol
Molar mass of c31h35n7o2s2zn is 667.1653 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of NiN(Si(CH3)3)2(P(C6H5)3)2 is 743.649144 g/mol
Molar mass of s3o3c12h17 is 305.45658 g/mol
Molar mass of HNO3 is 63.01284 g/mol
Molar mass of Ni(N(Si(CH3)3)2)(P(C6H5)3)2 is 743.649144 g/mol
Molar mass of (Cu(HOCH2CH(NH2)CO2)(H2O)(C12H8N2))2SO4 is 827.76508 g/mol
Molar mass of ZnSO4 is . g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of H2 is 2.01588 g/mol
Molar mass of s3o3c12 is 288.3216 g/mol
Molar mass of s3o3c12 is 288.3216 g/mol
Molar mass of ZnO is 81.3794 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of C10H30Si5O5 is 370.7697 g/mol
Molar mass of s3o3c12h18 is 306.46452 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Calculate molecular weight
Molecular weights calculated on 02/10/15 | Molecular weights calculated on 02/12/15 |
Molecular masses on 01/12/15
Molecular masses on 02/11/14
Please let us know how we can improve this web app.