Molecular weights calculated on 02/03/15 | Molecular weights calculated on 02/05/15 |
Molar mass of p is 30.973762 g/mol
Molar mass of SF is 51.0634032 g/mol
Molar mass of CH3CCH2COOCH2CH2OCH2CH2OCH2CH2OCH2CH2OCOONC4H4O2 is 403.3811 g/mol
Molar mass of N2O is 44.0128 g/mol
Molar mass of (NH4)3PO3 is 133.087342 g/mol
Molar mass of CH2CH2O is 44.05256 g/mol
Molar mass of o2 is 31.9988 g/mol
Molar mass of MnO2 is 86.936845 g/mol
Molar mass of MnO2 is 86.936845 g/mol
Molar mass of SF4 is 108.0586128 g/mol
Molar mass of o2 is 31.9988 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of Al2O3 is 101.9612772 g/mol
Molar mass of Si3N4 is 140.2833 g/mol
Molar mass of NH4HSO4 is 115.109 g/mol
Molar mass of Au(ClO)3 is 351.323769 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of P2H5CH is 80.005864 g/mol
Molar mass of MgCl2 is 95.211 g/mol
Molar mass of NaNH2 is 39.01234928 g/mol
Molar mass of Pb is + g/mol
Molar mass of C4H10 is 58.1222 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of BaCO3 is 197.3359 g/mol
Molar mass of c4h6no4 is 1090.49456 g/mol
Molar mass of HNO3 is 63.01284 g/mol
Molar mass of HBrO4 is 144.90954 g/mol
Molar mass of COOHCH2C(OH)(COOH)CH2COOH is 192.12352 g/mol
Molar mass of Ca is 40.078 g/mol
Molar mass of K2CO3 is 138.2055 g/mol
Molar mass of COOHCH2C(OH)(COOH) is 133.0795 g/mol
Molar mass of O3 is 47.9982 g/mol
Molar mass of c4h6n1o4 is 132.09474 g/mol
Molar mass of HNO3 is 63.01284 g/mol
Molar mass of NaNO2 is 68.99526928 g/mol
Molar mass of H2O2 is 34.01468 g/mol
Molar mass of C4H10(mg) is 58.1222 g/mol
Molar mass of Sr(NO3)2 is 211.6298 g/mol
Molar mass of Na3PO4 is 163.94066984 g/mol
Molar mass of Ca3N2 is 148.2474 g/mol
Molar mass of o2 is 31.9988 g/mol
Molar mass of CrS is 84.0611 g/mol
Molar mass of MgCl2 is 95.211 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of CH3CCH2COOCH2CH2OCH2CH2OCH2CH2OCH2CH2OCOONO2C6H6 is 429.41838 g/mol
Molar mass of Cr2S2 is 168.1222 g/mol
Molar mass of HF is 20.0063432 g/mol
Molar mass of NHBr4 is 334.63064 g/mol
Calculate molecular weight
Molecular weights calculated on 02/03/15 | Molecular weights calculated on 02/05/15 |
Molecular masses on 01/05/15
Molecular masses on 02/04/14
Please let us know how we can improve this web app.