| Molecular weights calculated on 05/22/09 | Molecular weights calculated on 05/24/09 |
| 1 2 3 4 5 6 |
Molar mass of CaCl2 is 110.9848 g/mol
Molar mass of CaCl2 is 110.9848 g/mol
Molar mass of Na2SO4 is 142.042758564 g/mol
Molar mass of CH3C(CH2CH2CH3)(OH)CH2CH3 is 116.202042 g/mol
Molar mass of CH3CH2CH2C(OH)CH3CH2CH3 is 116.202042 g/mol
Molar mass of Fe2O3 is 159.68869 g/mol
Molar mass of Al2 is 53.96307736 g/mol
Molar mass of Al(C5H8O2)3 is 327.33054668 g/mol
Molar mass of Ni6N2Cl6C24H is 882.159827 g/mol
Molar mass of Ni6N2Cl6C24H is 882.159827 g/mol
Molar mass of Ni6N2Cl6C28H2O is 947.210324 g/mol
Molar mass of Ni6N6C28H2O2Cl is 841.970634 g/mol
Molar mass of NiN6C6H28Cl2O2 is 345.926196 g/mol
Molar mass of FeCl3*6H2O is 270.296744 g/mol
Molar mass of C8N8H32Ni2Cl2 is 428.687544 g/mol
Molar mass of C8N8H32Ni2Cl4 is 499.593944 g/mol
Molar mass of C11H18NiN2O2 is 268.967346 g/mol
Molar mass of C12H18NiN2O2 is 280.978126 g/mol
Molar mass of NiN6C6H28Cl2O2 is 345.926196 g/mol
Molar mass of NiN6C6H28Cl2O2 is 345.926196 g/mol
Molar mass of Cu2SO4 is 223.15582 g/mol
Molar mass of (NH4)CO3 is 78.047578 g/mol
Molar mass of AgNO3 is 169.87323 g/mol
Molar mass of S is 32.0655 g/mol
Molar mass of Al2S3 is 150.15957736 g/mol
Molar mass of Al2(SO4)3 is 342.15273736 g/mol
Molar mass of N2O is 44.01287 g/mol
Molar mass of N2O is 44.01287 g/mol
| 1 2 3 4 5 6 |
| Molecular weights calculated on 05/22/09 | Molecular weights calculated on 05/24/09 |
Molecular masses on 04/23/09
Molecular masses on 05/23/08
Please let us know how we can improve this web app.
