| Molecular weights calculated on 07/14/08 | Molecular weights calculated on 07/16/08 |
| 1 2 3 4 5 |
Molar mass of Na2SO4 is 142.042758564 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of CO2 is 44.00964 g/mol
Molar mass of NaHCO3 is 84.006786282 g/mol
Molar mass of CoN2O12H12 is 291.0351595 g/mol
Molar mass of SCN2H4 is 76.121508 g/mol
Molar mass of (CH3)3CCl is 92.567843 g/mol
Molar mass of NaH2PO4 is 119.977145482 g/mol
Molar mass of Na2H2PO4 is 142.966914764 g/mol
Molar mass of NaOH is 39.997146282 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of LaF3 is 195.90068675 g/mol
Molar mass of Ag3PO4 is 418.5761422 g/mol
Molar mass of Zn(OH)2 is 99.424154 g/mol
Molar mass of Ag2CrO4 is 331.73032 g/mol
Molar mass of CoN2O6 is 182.9432155 g/mol
Molar mass of C3H9NC3H8NO5P is 228.1841312 g/mol
Molar mass of CH3N(CH2CH2O)H2(CH2CH2O)H2 is 121.178685 g/mol
| 1 2 3 4 5 |
| Molecular weights calculated on 07/14/08 | Molecular weights calculated on 07/16/08 |
Molecular masses on 06/15/08
Molecular masses on 07/15/07
Please let us know how we can improve this web app.
