| Molecular weights calculated on 02/19/08 | Molecular weights calculated on 02/21/08 |
| 1 2 3 4 5 6 7 8 9 10 11 12 13 |
Molar mass of CH3COOH is 60.052208 g/mol
Molar mass of Fe2O3 is 159.68869 g/mol
Molar mass of Pb(NO3)2 is 331.22002 g/mol
Molar mass of Ga2(SO3)3 is 379.63757 g/mol
Molar mass of Na2CO3 is 105.988608564 g/mol
Molar mass of NaOH is 39.997146282 g/mol
Molar mass of MgBr2 is 184.11326 g/mol
Molar mass of KCI is 178.013563 g/mol
Molar mass of O2 is 31.99886 g/mol
Molar mass of FeCl3 is 162.2048 g/mol
Molar mass of CaCO3 is 100.08747 g/mol
Molar mass of FeCl2 is 126.7516 g/mol
Molar mass of Zn(OH)2 is 99.424154 g/mol
Molar mass of Be2SO4 is 114.0875846 g/mol
Molar mass of CrF2 is 89.9929665 g/mol
Molar mass of Al2S3 is 150.15957736 g/mol
Molar mass of PbO is 223.20943 g/mol
Molar mass of Li3PO4 is 115.7950822 g/mol
Molar mass of TiI4 is 555.484992 g/mol
Molar mass of Co3N2 is 204.8130265 g/mol
Molar mass of Mg3P2 is 134.8627044 g/mol
Molar mass of HCl is 36.461147 g/mol
Molar mass of Ga(NO2)3 is 207.73984 g/mol
Molar mass of Ag2SO3 is 295.80023 g/mol
Molar mass of NH4OH is 35.045885 g/mol
Molar mass of H2 is 2.015894 g/mol
Molar mass of Al(CN)3 is 105.03403868 g/mol
Molar mass of Be(CH3COO)2 is 127.1007043 g/mol
Molar mass of OCH2CH2 is 44.052778 g/mol
Molar mass of (OCH2CH2)4 is 176.211112 g/mol
Molar mass of Pb(NO3)2 is 331.22002 g/mol
Molar mass of CH3(CH2)10CH2(OCH2CH2)4OH is 362.546524 g/mol
Molar mass of CaCl2 is 110.9848 g/mol
Molar mass of CaCl2 is 110.9848 g/mol
Molar mass of Br2 is 159.8082 g/mol
Molar mass of Al is 26.98153868 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of C6H3Cl3O is 197.447551 g/mol
Molar mass of C2H6O is 46.068672 g/mol
Molar mass of C6H5CHCHCOOH is 148.159456 g/mol
Molar mass of C5H6Br3N is 319.820602 g/mol
Molar mass of NaOH is 39.997146282 g/mol
Molar mass of (CH3)3COH is 74.12202 g/mol
Molar mass of CO2 is 44.00964 g/mol
Molar mass of Ag2S is 247.80194 g/mol
Molar mass of CS2 is 76.14178 g/mol
Molar mass of Na2CO3 is 105.988608564 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of C is 12.01078 g/mol
| 1 2 3 4 5 6 7 8 9 10 11 12 13 |
| Molecular weights calculated on 02/19/08 | Molecular weights calculated on 02/21/08 |
Molecular masses on 01/21/08
Molecular masses on 02/20/07
Please let us know how we can improve this web app.
