Molar mass of Si80(Pb2I2HgP2C55H72Br2SO7SeFN4)33 is 72264.9414 g/mol
Elemental composition of Si80(Pb2I2HgP2C55H72Br2SO7SeFN4)33
Formula in Hill system is C1815H2376Br66F33Hg33I66N132O231P66Pb66S33Se33Si80 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Computing molar mass (molar weight)To calculate molar mass of a chemical compound enter its formula and click 'Compute'. In chemical formula you may use:
Molar mass calculator also displays common compound name, Hill formula, elemental composition, mass percent composition, atomic percent compositions and allows to convert from weight to number of moles and vice versa. Computing molecular weight (molecular mass)To calculate molecular weight of a chemical compound enter it's formula, specify its isotope mass number after each element in square brackets.Examples of molecular weight computations: C[14]O[16]2, S[34]O[16]2. Definitions
Steps to calculate molar mass
Example: calculating molar massLet's calculate the molar mass of carbon dioxide (CO2):
Lesson on computing molar massWeights of atoms and isotopes are from NIST article. Related: Molecular weights of amino acids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
molecular weights calculated today |